C10H18F3NO2S — CID 58689137
1,1,1-trifluoro-N-(4-propan-2-ylcyclohexyl)methanesulfonamide (PubChem CID 58689137) has the molecular formula C10H18F3NO2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(4-propan-2-ylcyclohexyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(4-propan-2-ylcyclohexyl)methanesulfonamide |
|---|---|
| PubChem CID | 58689137 |
| Molecular Formula | C10H18F3NO2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1,1,1-trifluoro-N-(4-propan-2-ylcyclohexyl)methanesulfonamide |
| SMILES | CC(C)C1CCC(NS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H18F3NO2S/c1-7(2)8-3-5-9(6-4-8)14-17(15,16)10(11,12)13/h7-9,14H,3-6H2,1-2H3 |
| InChIKey | PINHQTPOKJBZKQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |