C26H26O4 — CID 58689535
ethyl 1-[3-(4-ethenylphenoxy)-3-oxoprop-1-en-2-yl]-3-phenylbicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 58689535) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is ethyl 1-[3-(4-ethenylphenoxy)-3-oxoprop-1-en-2-yl]-3-phenylbicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | ethyl 1-[3-(4-ethenylphenoxy)-3-oxoprop-1-en-2-yl]-3-phenylbicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 58689535 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | ethyl 1-[3-(4-ethenylphenoxy)-3-oxoprop-1-en-2-yl]-3-phenylbicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | C=Cc1ccc(OC(=O)C(=C)C23CC2CC(C(=O)OCC)(c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C26H26O4/c1-4-19-11-13-22(14-12-19)30-23(27)18(3)25-15-21(25)16-26(17-25,24(28)29-5-2)20-9-7-6-8-10-20/h4,6-14,21H,1,3,5,15-17H2,2H3 |
| InChIKey | VVZUPTMUFSGLKC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|