C24H24N2OS3 — CID 58690655
(5E)-5-(3-butyl-4,5-diphenyl-1,3-thiazol-2-ylidene)-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 58690655) has the molecular formula C24H24N2OS3 and a molecular weight of 452.67 g/mol. Its IUPAC name is (5E)-5-(3-butyl-4,5-diphenyl-1,3-thiazol-2-ylidene)-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-(3-butyl-4,5-diphenyl-1,3-thiazol-2-ylidene)-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58690655 |
| Molecular Formula | C24H24N2OS3 |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | (5E)-5-(3-butyl-4,5-diphenyl-1,3-thiazol-2-ylidene)-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(c2ccccc2)=C(c2ccccc2)S/C1=C1/SC(=S)N(CC)C1=O |
| InChI | InChI=1S/C24H24N2OS3/c1-3-5-16-26-19(17-12-8-6-9-13-17)20(18-14-10-7-11-15-18)29-23(26)21-22(27)25(4-2)24(28)30-21/h6-15H,3-5,16H2,1-2H3/b23-21+ |
| InChIKey | ODLCVFQAQYRUCD-XTQSDGFTSA-N |
| XLogP | 6.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|