C13H19F2NO2S — CID 58692031
(2S)-2-fluoro-3-[[1-(4-fluorophenyl)-2-methylpropan-2-yl]amino]propane-1-sulfinic acid (PubChem CID 58692031) has the molecular formula C13H19F2NO2S and a molecular weight of 291.36 g/mol. Its IUPAC name is (2S)-2-fluoro-3-[[1-(4-fluorophenyl)-2-methylpropan-2-yl]amino]propane-1-sulfinic acid.
| Compound Name | (2S)-2-fluoro-3-[[1-(4-fluorophenyl)-2-methylpropan-2-yl]amino]propane-1-sulfinic acid |
|---|---|
| PubChem CID | 58692031 |
| Molecular Formula | C13H19F2NO2S |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (2S)-2-fluoro-3-[[1-(4-fluorophenyl)-2-methylpropan-2-yl]amino]propane-1-sulfinic acid |
| SMILES | CC(C)(Cc1ccc(F)cc1)NC[C@H](F)CS(=O)O |
| InChI | InChI=1S/C13H19F2NO2S/c1-13(2,16-8-12(15)9-19(17)18)7-10-3-5-11(14)6-4-10/h3-6,12,16H,7-9H2,1-2H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | AROAWRSNMODXAR-LBPRGKRZSA-N |
| XLogP | 2.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|