C25H23N3O — CID 58694548
2-benzyl-1-phenyl-7-pyrrolidin-1-yl-1,6-naphthyridin-4-one (PubChem CID 58694548) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-benzyl-1-phenyl-7-pyrrolidin-1-yl-1,6-naphthyridin-4-one.
| Compound Name | 2-benzyl-1-phenyl-7-pyrrolidin-1-yl-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 58694548 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-benzyl-1-phenyl-7-pyrrolidin-1-yl-1,6-naphthyridin-4-one |
| SMILES | O=c1cc(Cc2ccccc2)n(-c2ccccc2)c2cc(N3CCCC3)ncc12 |
| InChI | InChI=1S/C25H23N3O/c29-24-16-21(15-19-9-3-1-4-10-19)28(20-11-5-2-6-12-20)23-17-25(26-18-22(23)24)27-13-7-8-14-27/h1-6,9-12,16-18H,7-8,13-15H2 |
| InChIKey | OMAGUWXCDMBJHM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |