C24H18N4S — CID 58704171
N-phenyl-6-pyrazol-1-yl-N-(3-thiophen-3-ylphenyl)pyridin-2-amine (PubChem CID 58704171) has the molecular formula C24H18N4S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-phenyl-6-pyrazol-1-yl-N-(3-thiophen-3-ylphenyl)pyridin-2-amine.
| Compound Name | N-phenyl-6-pyrazol-1-yl-N-(3-thiophen-3-ylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 58704171 |
| Molecular Formula | C24H18N4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-phenyl-6-pyrazol-1-yl-N-(3-thiophen-3-ylphenyl)pyridin-2-amine |
| SMILES | c1ccc(N(c2cccc(-c3ccsc3)c2)c2cccc(-n3cccn3)n2)cc1 |
| InChI | InChI=1S/C24H18N4S/c1-2-8-21(9-3-1)28(22-10-4-7-19(17-22)20-13-16-29-18-20)24-12-5-11-23(26-24)27-15-6-14-25-27/h1-18H |
| InChIKey | RDYAKOCJJRTDCE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |