C32H21N5Pt — CID 58704277
N,N-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)anthracen-9-amine;platinum(2+) (PubChem CID 58704277) has the molecular formula C32H21N5Pt and a molecular weight of 670.63 g/mol. Its IUPAC name is N,N-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)anthracen-9-amine;platinum(2+).
| Compound Name | N,N-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)anthracen-9-amine;platinum(2+) |
|---|---|
| PubChem CID | 58704277 |
| Molecular Formula | C32H21N5Pt |
| Molecular Weight | 670.63 g/mol |
| Exact Mass | 670.14 |
| IUPAC Name | N,N-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)anthracen-9-amine;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(N(c2[c-]c(-n3cccn3)ccc2)c2c3ccccc3cc3ccccc23)cccc1-n1cccn1 |
| InChI | InChI=1S/C32H21N5.Pt/c1-3-15-30-24(9-1)21-25-10-2-4-16-31(25)32(30)37(28-13-5-11-26(22-28)35-19-7-17-33-35)29-14-6-12-27(23-29)36-20-8-18-34-36;/h1-21H;/q-2;+2 |
| InChIKey | SNLJFACWTBTNNW-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.63 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|