C15H9IrN2S- — CID 59858882
1-(3H-dibenzothiophen-3-id-2-yl)pyrazole;iridium (PubChem CID 59858882) has the molecular formula C15H9IrN2S- and a molecular weight of 441.54 g/mol. Its IUPAC name is 1-(3H-dibenzothiophen-3-id-2-yl)pyrazole;iridium.
| Compound Name | 1-(3H-dibenzothiophen-3-id-2-yl)pyrazole;iridium |
|---|---|
| PubChem CID | 59858882 |
| Molecular Formula | C15H9IrN2S- |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 1-(3H-dibenzothiophen-3-id-2-yl)pyrazole;iridium |
| SMILES | [Ir].[c-]1cc2sc3ccccc3c2cc1-n1cccn1 |
| InChI | InChI=1S/C15H9N2S.Ir/c1-2-5-14-12(4-1)13-10-11(6-7-15(13)18-14)17-9-3-8-16-17;/h1-5,7-10H;/q-1; |
| InChIKey | FLZDGCOHRZFDHW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|