C14H21NO4 — CID 58705646
tert-butyl 5-acetyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 58705646) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is tert-butyl 5-acetyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 5-acetyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58705646 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | tert-butyl 5-acetyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CCC1CC(C(C)=O)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C14H21NO4/c1-6-7-10-8-11(9(2)16)15(12(10)17)13(18)19-14(3,4)5/h6,10-11H,1,7-8H2,2-5H3 |
| InChIKey | OHZNFHODSDRKDH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|