C13H19NO2 — CID 58605319
(5S)-5-acetyl-1-methyl-3,3-bis(prop-2-enyl)pyrrolidin-2-one (PubChem CID 58605319) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (5S)-5-acetyl-1-methyl-3,3-bis(prop-2-enyl)pyrrolidin-2-one.
| Compound Name | (5S)-5-acetyl-1-methyl-3,3-bis(prop-2-enyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 58605319 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (5S)-5-acetyl-1-methyl-3,3-bis(prop-2-enyl)pyrrolidin-2-one |
| SMILES | C=CCC1(CC=C)C[C@@H](C(C)=O)N(C)C1=O |
| InChI | InChI=1S/C13H19NO2/c1-5-7-13(8-6-2)9-11(10(3)15)14(4)12(13)16/h5-6,11H,1-2,7-9H2,3-4H3/t11-/m0/s1 |
| InChIKey | SDFOUNIMRYQRKB-NSHDSACASA-N |
| XLogP | 1.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|