C17H25NO4 — CID 58705563
tert-butyl 5-acetyl-2-oxo-3,3-bis(prop-2-enyl)pyrrolidine-1-carboxylate (PubChem CID 58705563) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl 5-acetyl-2-oxo-3,3-bis(prop-2-enyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 5-acetyl-2-oxo-3,3-bis(prop-2-enyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58705563 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | tert-butyl 5-acetyl-2-oxo-3,3-bis(prop-2-enyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCC1(CC=C)CC(C(C)=O)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C17H25NO4/c1-7-9-17(10-8-2)11-13(12(3)19)18(14(17)20)15(21)22-16(4,5)6/h7-8,13H,1-2,9-11H2,3-6H3 |
| InChIKey | UZQWZHXRAICRCX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|