C18H29NO5 — CID 91056174
tert-butyl 5-acetyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxylate;oxolane (PubChem CID 91056174) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is tert-butyl 5-acetyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxylate;oxolane.
| Compound Name | tert-butyl 5-acetyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxylate;oxolane |
|---|---|
| PubChem CID | 91056174 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | tert-butyl 5-acetyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxylate;oxolane |
| SMILES | C1CCOC1.C=CCC1CC(C(C)=O)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C14H21NO4.C4H8O/c1-6-7-10-8-11(9(2)16)15(12(10)17)13(18)19-14(3,4)5;1-2-4-5-3-1/h6,10-11H,1,7-8H2,2-5H3;1-4H2 |
| InChIKey | ZAQPAEUWIGINRI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|