C20H25NO — CID 58707760
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-methyl-1H-inden-2-yl)methanone (PubChem CID 58707760) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-methyl-1H-inden-2-yl)methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-methyl-1H-inden-2-yl)methanone |
|---|---|
| PubChem CID | 58707760 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-methyl-1H-inden-2-yl)methanone |
| SMILES | CC1=C(C(=O)N2CCC[C@H]3CCCC[C@H]32)Cc2ccccc21 |
| InChI | InChI=1S/C20H25NO/c1-14-17-10-4-2-8-16(17)13-18(14)20(22)21-12-6-9-15-7-3-5-11-19(15)21/h2,4,8,10,15,19H,3,5-7,9,11-13H2,1H3/t15-,19-/m1/s1 |
| InChIKey | HKJSWQDTLZRSLH-DNVCBOLYSA-N |
| XLogP | 4.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |