C28H24N6O3 — CID 58708370
N-[5-[(2-aminophenyl)carbamoyl]-2-[(3-methyl-2-oxobenzimidazol-1-yl)methyl]phenyl]pyridine-3-carboxamide (PubChem CID 58708370) has the molecular formula C28H24N6O3 and a molecular weight of 492.54 g/mol. Its IUPAC name is N-[5-[(2-aminophenyl)carbamoyl]-2-[(3-methyl-2-oxobenzimidazol-1-yl)methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[5-[(2-aminophenyl)carbamoyl]-2-[(3-methyl-2-oxobenzimidazol-1-yl)methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58708370 |
| Molecular Formula | C28H24N6O3 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | N-[5-[(2-aminophenyl)carbamoyl]-2-[(3-methyl-2-oxobenzimidazol-1-yl)methyl]phenyl]pyridine-3-carboxamide |
| SMILES | Cn1c(=O)n(Cc2ccc(C(=O)Nc3ccccc3N)cc2NC(=O)c2cccnc2)c2ccccc21 |
| InChI | InChI=1S/C28H24N6O3/c1-33-24-10-4-5-11-25(24)34(28(33)37)17-20-13-12-18(26(35)31-22-9-3-2-8-21(22)29)15-23(20)32-27(36)19-7-6-14-30-16-19/h2-16H,17,29H2,1H3,(H,31,35)(H,32,36) |
| InChIKey | ZFXHPXSRLXBTNP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|