About platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide)
platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide) (PubChem CID 58711211) has the molecular formula C18H12F6N6Pt
and a molecular weight of 621.40 g/mol. Its IUPAC name is platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide).
Molecular Properties
| Compound Name | platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide) |
| PubChem CID | 58711211 |
| Molecular Formula | C18H12F6N6Pt |
| Molecular Weight | 621.40 g/mol |
| Exact Mass | 621.07 |
| IUPAC Name | platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide) |
| SMILES | FC(F)(F)c1cc[n-]n1.FC(F)(F)c1cc[n-]n1.[Pt+2].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.2C4H2F3N2.Pt/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*5-4(6,7)3-1-2-8-9-3;/h1-8H;2*1-2H;/q;2*-1;+2 |
| InChIKey | WOLSKEJNKNLAHK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 621.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide)?
The IUPAC name of platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide) (CID 58711211) is platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide).
What is the SMILES notation for platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide)?
The canonical SMILES for platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide) is FC(F)(F)c1cc[n-]n1.FC(F)(F)c1cc[n-]n1.[Pt+2].c1ccc(-c2ccccn2)nc1.
What is the InChIKey of platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide)?
The InChIKey is WOLSKEJNKNLAHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2C4H2F3N2.Pt/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*5-4(6,7)3-1-2-8-9-3;/h1-8H;2*1-2H;/q;2*-1;+2.
What are the key properties of platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide)?
platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide) has a molecular weight of 621.40 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for platinum(2+);2-pyridin-2-ylpyridine;bis(3-(trifluoromethyl)pyrazol-1-ide) is sourced from PubChem (CID 58711211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).