C12H15O2Y- — CID 58711672
3-(3,5-dimethylbenzene-4-id-1-yl)oxybutan-2-one;yttrium (PubChem CID 58711672) has the molecular formula C12H15O2Y- and a molecular weight of 280.16 g/mol. Its IUPAC name is 3-(3,5-dimethylbenzene-4-id-1-yl)oxybutan-2-one;yttrium.
| Compound Name | 3-(3,5-dimethylbenzene-4-id-1-yl)oxybutan-2-one;yttrium |
|---|---|
| PubChem CID | 58711672 |
| Molecular Formula | C12H15O2Y- |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 3-(3,5-dimethylbenzene-4-id-1-yl)oxybutan-2-one;yttrium |
| SMILES | CC(=O)C(C)Oc1cc(C)[c-]c(C)c1.[Y] |
| InChI | InChI=1S/C12H15O2.Y/c1-8-5-9(2)7-12(6-8)14-11(4)10(3)13;/h6-7,11H,1-4H3;/q-1; |
| InChIKey | HKCVQLUTEQMPIA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|