C12H16O2Y-2 — CID 59905131
carbanide;1-(2,6-dimethylbenzene-4-id-1-yl)oxypropan-2-one;yttrium (PubChem CID 59905131) has the molecular formula C12H16O2Y-2 and a molecular weight of 281.16 g/mol. Its IUPAC name is carbanide;1-(2,6-dimethylbenzene-4-id-1-yl)oxypropan-2-one;yttrium.
| Compound Name | carbanide;1-(2,6-dimethylbenzene-4-id-1-yl)oxypropan-2-one;yttrium |
|---|---|
| PubChem CID | 59905131 |
| Molecular Formula | C12H16O2Y-2 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | carbanide;1-(2,6-dimethylbenzene-4-id-1-yl)oxypropan-2-one;yttrium |
| SMILES | CC(=O)COc1c(C)c[c-]cc1C.[CH3-].[Y] |
| InChI | InChI=1S/C11H13O2.CH3.Y/c1-8-5-4-6-9(2)11(8)13-7-10(3)12;;/h5-6H,7H2,1-3H3;1H3;/q2*-1; |
| InChIKey | FGCOLQUFDDKPFS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|