About 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium
1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium (PubChem CID 158159878) has the molecular formula C14H21O2Rh-
and a molecular weight of 324.23 g/mol. Its IUPAC name is 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium.
Molecular Properties
| Compound Name | 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium |
| PubChem CID | 158159878 |
| Molecular Formula | C14H21O2Rh- |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium |
| SMILES | C.CC(=O)COc1[c-]cc(C(C)(C)C)cc1.[Rh] |
| InChI | InChI=1S/C13H17O2.CH4.Rh/c1-10(14)9-15-12-7-5-11(6-8-12)13(2,3)4;;/h5-7H,9H2,1-4H3;1H4;/q-1;; |
| InChIKey | JOXQGFUKPRVIRH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium?
The IUPAC name of 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium (CID 158159878) is 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium.
What is the SMILES notation for 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium?
The canonical SMILES for 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium is C.CC(=O)COc1[c-]cc(C(C)(C)C)cc1.[Rh].
What is the InChIKey of 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium?
The InChIKey is JOXQGFUKPRVIRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17O2.CH4.Rh/c1-10(14)9-15-12-7-5-11(6-8-12)13(2,3)4;;/h5-7H,9H2,1-4H3;1H4;/q-1;;.
What are the key properties of 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium?
1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium has a molecular weight of 324.23 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;methane;rhodium is sourced from PubChem (CID 158159878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).