C21H34O3 — CID 142155175
ethane;1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-3-(3-methylcyclohexa-1,5-dien-1-yl)oxypropan-2-one (PubChem CID 142155175) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is ethane;1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-3-(3-methylcyclohexa-1,5-dien-1-yl)oxypropan-2-one.
| Compound Name | ethane;1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-3-(3-methylcyclohexa-1,5-dien-1-yl)oxypropan-2-one |
|---|---|
| PubChem CID | 142155175 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | ethane;1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-3-(3-methylcyclohexa-1,5-dien-1-yl)oxypropan-2-one |
| SMILES | C=C/C=C\C(=C/C)OCC(=O)COC1=CC(C)CC=C1.CC.CC |
| InChI | InChI=1S/C17H22O3.2C2H6/c1-4-6-9-16(5-2)19-12-15(18)13-20-17-10-7-8-14(3)11-17;2*1-2/h4-7,9-11,14H,1,8,12-13H2,2-3H3;2*1-2H3/b9-6-,16-5+;; |
| InChIKey | AFXFFDFLHMMQIP-IZPUFMBKSA-N |
| XLogP | 5.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|