About 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+)
1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+) (PubChem CID 21056969) has the molecular formula C13H17O2Rh+
and a molecular weight of 308.18 g/mol. Its IUPAC name is 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+).
Molecular Properties
| Compound Name | 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+) |
| PubChem CID | 21056969 |
| Molecular Formula | C13H17O2Rh+ |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+) |
| SMILES | CC(=O)COc1[c-]cc(C(C)(C)C)cc1.[Rh+2] |
| InChI | InChI=1S/C13H17O2.Rh/c1-10(14)9-15-12-7-5-11(6-8-12)13(2,3)4;/h5-7H,9H2,1-4H3;/q-1;+2 |
| InChIKey | CBBZCUMJISSNNI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+)?
The IUPAC name of 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+) (CID 21056969) is 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+).
What is the SMILES notation for 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+)?
The canonical SMILES for 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+) is CC(=O)COc1[c-]cc(C(C)(C)C)cc1.[Rh+2].
What is the InChIKey of 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+)?
The InChIKey is CBBZCUMJISSNNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17O2.Rh/c1-10(14)9-15-12-7-5-11(6-8-12)13(2,3)4;/h5-7H,9H2,1-4H3;/q-1;+2.
What are the key properties of 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+)?
1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+) has a molecular weight of 308.18 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butylbenzene-6-id-1-yl)oxypropan-2-one;rhodium(2+) is sourced from PubChem (CID 21056969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).