C17H22O3 — CID 142155176
1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-3-(3-methylcyclohexa-1,5-dien-1-yl)oxypropan-2-one (PubChem CID 142155176) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-3-(3-methylcyclohexa-1,5-dien-1-yl)oxypropan-2-one.
| Compound Name | 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-3-(3-methylcyclohexa-1,5-dien-1-yl)oxypropan-2-one |
|---|---|
| PubChem CID | 142155176 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-3-(3-methylcyclohexa-1,5-dien-1-yl)oxypropan-2-one |
| SMILES | C=C/C=C\C(=C/C)OCC(=O)COC1=CC(C)CC=C1 |
| InChI | InChI=1S/C17H22O3/c1-4-6-9-16(5-2)19-12-15(18)13-20-17-10-7-8-14(3)11-17/h4-7,9-11,14H,1,8,12-13H2,2-3H3/b9-6-,16-5+ |
| InChIKey | OUACIRKWECFSOU-NVPJBRJLSA-N |
| XLogP | 3.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|