C23H24ClFN4O2 — CID 58711861
2-methylpropyl 4-[7-chloro-2-(2-fluorophenyl)quinazolin-4-yl]piperazine-1-carboxylate (PubChem CID 58711861) has the molecular formula C23H24ClFN4O2 and a molecular weight of 442.92 g/mol. Its IUPAC name is 2-methylpropyl 4-[7-chloro-2-(2-fluorophenyl)quinazolin-4-yl]piperazine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[7-chloro-2-(2-fluorophenyl)quinazolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58711861 |
| Molecular Formula | C23H24ClFN4O2 |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-methylpropyl 4-[7-chloro-2-(2-fluorophenyl)quinazolin-4-yl]piperazine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCN(c2nc(-c3ccccc3F)nc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C23H24ClFN4O2/c1-15(2)14-31-23(30)29-11-9-28(10-12-29)22-18-8-7-16(24)13-20(18)26-21(27-22)17-5-3-4-6-19(17)25/h3-8,13,15H,9-12,14H2,1-2H3 |
| InChIKey | UAXPHDNHODRUCZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |