C12H22 — CID 58715430
(1S,2R,5S)-2-ethyl-8,8-dimethylbicyclo[3.2.1]octane (PubChem CID 58715430) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is (1S,2R,5S)-2-ethyl-8,8-dimethylbicyclo[3.2.1]octane.
| Compound Name | (1S,2R,5S)-2-ethyl-8,8-dimethylbicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 58715430 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (1S,2R,5S)-2-ethyl-8,8-dimethylbicyclo[3.2.1]octane |
| SMILES | CC[C@@H]1CC[C@H]2CC[C@@H]1C2(C)C |
| InChI | InChI=1S/C12H22/c1-4-9-5-6-10-7-8-11(9)12(10,2)3/h9-11H,4-8H2,1-3H3/t9-,10+,11+/m1/s1 |
| InChIKey | CMOVEBVFAAKFOT-VWYCJHECSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |