C10H12N2 — CID 58717057
3-cyclohexa-1,5-dien-1-yl-5-methyl-4H-pyrazole (PubChem CID 58717057) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-5-methyl-4H-pyrazole.
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-5-methyl-4H-pyrazole |
|---|---|
| PubChem CID | 58717057 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-5-methyl-4H-pyrazole |
| SMILES | CC1=NN=C(C2=CCCC=C2)C1 |
| InChI | InChI=1S/C10H12N2/c1-8-7-10(12-11-8)9-5-3-2-4-6-9/h3,5-6H,2,4,7H2,1H3 |
| InChIKey | LJCSSJCKTXYEPT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |