About 7-methoxy-2,3-dimethylquinoline
7-methoxy-2,3-dimethylquinoline (PubChem CID 58717059) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 7-methoxy-2,3-dimethylquinoline.
Molecular Properties
| Compound Name | 7-methoxy-2,3-dimethylquinoline |
| PubChem CID | 58717059 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 7-methoxy-2,3-dimethylquinoline |
| SMILES | COc1ccc2cc(C)c(C)nc2c1 |
| InChI | InChI=1S/C12H13NO/c1-8-6-10-4-5-11(14-3)7-12(10)13-9(8)2/h4-7H,1-3H3 |
| InChIKey | UQSIDNNGBUIAFO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methoxy-2,3-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-2,3-dimethylquinoline?
The IUPAC name of 7-methoxy-2,3-dimethylquinoline (CID 58717059) is 7-methoxy-2,3-dimethylquinoline.
What is the SMILES notation for 7-methoxy-2,3-dimethylquinoline?
The canonical SMILES for 7-methoxy-2,3-dimethylquinoline is COc1ccc2cc(C)c(C)nc2c1.
What is the InChIKey of 7-methoxy-2,3-dimethylquinoline?
The InChIKey is UQSIDNNGBUIAFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c1-8-6-10-4-5-11(14-3)7-12(10)13-9(8)2/h4-7H,1-3H3.
What are the key properties of 7-methoxy-2,3-dimethylquinoline?
7-methoxy-2,3-dimethylquinoline has a molecular weight of 187.24 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2,3-dimethylquinoline is sourced from PubChem (CID 58717059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).