C39H37NO4 — CID 58717737
(2S)-2-[(5-tert-butyl-2-hydroxyphenyl)methyl-(4-phenylbenzoyl)amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 58717737) has the molecular formula C39H37NO4 and a molecular weight of 583.73 g/mol. Its IUPAC name is (2S)-2-[(5-tert-butyl-2-hydroxyphenyl)methyl-(4-phenylbenzoyl)amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | (2S)-2-[(5-tert-butyl-2-hydroxyphenyl)methyl-(4-phenylbenzoyl)amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 58717737 |
| Molecular Formula | C39H37NO4 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | (2S)-2-[(5-tert-butyl-2-hydroxyphenyl)methyl-(4-phenylbenzoyl)amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | CC(C)(C)c1ccc(O)c(CN(C(=O)c2ccc(-c3ccccc3)cc2)[C@@H](Cc2ccc(-c3ccccc3)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C39H37NO4/c1-39(2,3)34-22-23-36(41)33(25-34)26-40(37(42)32-20-18-31(19-21-32)29-12-8-5-9-13-29)35(38(43)44)24-27-14-16-30(17-15-27)28-10-6-4-7-11-28/h4-23,25,35,41H,24,26H2,1-3H3,(H,43,44)/t35-/m0/s1 |
| InChIKey | FNAWNPMFYOXCOV-DHUJRADRSA-N |
| XLogP | 8.36 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|