C36H33F3N3O5S+ — CID 142862160
CID 142862160 (PubChem CID 142862160) has the molecular formula C36H33F3N3O5S+ and a molecular weight of 676.74 g/mol.
| Compound Name | CID 142862160 |
|---|---|
| PubChem CID | 142862160 |
| Molecular Formula | C36H33F3N3O5S+ |
| Molecular Weight | 676.74 g/mol |
| Exact Mass | 676.21 |
| IUPAC Name | — |
| SMILES | Cc1noc(C)c1[SH+](=O)NCCN(C(=O)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1)[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C36H32F3N3O5S/c1-23-33(24(2)47-41-23)48(46)40-20-21-42(32(35(44)45)22-25-8-10-27(11-9-25)26-6-4-3-5-7-26)34(43)30-14-12-28(13-15-30)29-16-18-31(19-17-29)36(37,38)39/h3-19,32H,20-22H2,1-2H3,(H,40,46)(H,44,45)/p+1/t32-,48?/m0/s1 |
| InChIKey | GWBVEKCAJQPOKU-CKYSKPARSA-O |
| XLogP | 7.04 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.74 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|