C52H45NO5 — CID 58718014
(2S)-2-[[5-tert-butyl-2-(4-phenylbenzoyl)oxyphenyl]methyl-(4-phenylbenzoyl)amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 58718014) has the molecular formula C52H45NO5 and a molecular weight of 763.93 g/mol. Its IUPAC name is (2S)-2-[[5-tert-butyl-2-(4-phenylbenzoyl)oxyphenyl]methyl-(4-phenylbenzoyl)amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | (2S)-2-[[5-tert-butyl-2-(4-phenylbenzoyl)oxyphenyl]methyl-(4-phenylbenzoyl)amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 58718014 |
| Molecular Formula | C52H45NO5 |
| Molecular Weight | 763.93 g/mol |
| Exact Mass | 763.33 |
| IUPAC Name | (2S)-2-[[5-tert-butyl-2-(4-phenylbenzoyl)oxyphenyl]methyl-(4-phenylbenzoyl)amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | CC(C)(C)c1ccc(OC(=O)c2ccc(-c3ccccc3)cc2)c(CN(C(=O)c2ccc(-c3ccccc3)cc2)[C@@H](Cc2ccc(-c3ccccc3)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C52H45NO5/c1-52(2,3)46-31-32-48(58-51(57)44-29-25-42(26-30-44)39-17-11-6-12-18-39)45(34-46)35-53(49(54)43-27-23-41(24-28-43)38-15-9-5-10-16-38)47(50(55)56)33-36-19-21-40(22-20-36)37-13-7-4-8-14-37/h4-32,34,47H,33,35H2,1-3H3,(H,55,56)/t47-/m0/s1 |
| InChIKey | CIMPOBVANSWGLV-MFERNQICSA-N |
| XLogP | 11.54 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.93 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|