C9H14N2O3 — CID 58719626
ethyl (1R,2S,3R)-2-[amino(isocyano)methyl]-3-(hydroxymethyl)cyclopropane-1-carboxylate (PubChem CID 58719626) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is ethyl (1R,2S,3R)-2-[amino(isocyano)methyl]-3-(hydroxymethyl)cyclopropane-1-carboxylate.
| Compound Name | ethyl (1R,2S,3R)-2-[amino(isocyano)methyl]-3-(hydroxymethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 58719626 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | ethyl (1R,2S,3R)-2-[amino(isocyano)methyl]-3-(hydroxymethyl)cyclopropane-1-carboxylate |
| SMILES | [C-]#[N+]C(N)[C@H]1[C@@H](CO)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C9H14N2O3/c1-3-14-9(13)7-5(4-12)6(7)8(10)11-2/h5-8,12H,3-4,10H2,1H3/t5-,6+,7+,8?/m1/s1 |
| InChIKey | NZLGLKBAFIYIIU-JXMHAVLCSA-N |
| XLogP | -0.39 |
| TPSA | 76.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|