C22H24N8+2 — CID 58721007
1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole (PubChem CID 58721007) has the molecular formula C22H24N8+2 and a molecular weight of 400.49 g/mol. Its IUPAC name is 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole.
| Compound Name | 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole |
|---|---|
| PubChem CID | 58721007 |
| Molecular Formula | C22H24N8+2 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole |
| SMILES | c1cn(Cc2cc(C[n+]3cc[nH]c3)c(C[n+]3cc[nH]c3)cc2Cn2ccnc2)cn1 |
| InChI | InChI=1S/C22H22N8/c1-5-27(15-23-1)11-19-9-21(13-29-7-3-25-17-29)22(14-30-8-4-26-18-30)10-20(19)12-28-6-2-24-16-28/h1-10,15-18H,11-14H2/p+2 |
| InChIKey | YSFJZLVJLAOPGF-UHFFFAOYSA-P |
| XLogP | 1.50 |
| TPSA | 74.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|