About 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole
1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole (PubChem CID 58721007) has the molecular formula C22H24N8+2
and a molecular weight of 400.49 g/mol. Its IUPAC name is 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole.
Molecular Properties
| Compound Name | 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole |
| PubChem CID | 58721007 |
| Molecular Formula | C22H24N8+2 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole |
| SMILES | c1cn(Cc2cc(C[n+]3cc[nH]c3)c(C[n+]3cc[nH]c3)cc2Cn2ccnc2)cn1 |
| InChI | InChI=1S/C22H22N8/c1-5-27(15-23-1)11-19-9-21(13-29-7-3-25-17-29)22(14-30-8-4-26-18-30)10-20(19)12-28-6-2-24-16-28/h1-10,15-18H,11-14H2/p+2 |
| InChIKey | YSFJZLVJLAOPGF-UHFFFAOYSA-P |
| XLogP | 1.50 |
| TPSA | 74.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole?
The IUPAC name of 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole (CID 58721007) is 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole.
What is the SMILES notation for 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole?
The canonical SMILES for 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole is c1cn(Cc2cc(C[n+]3cc[nH]c3)c(C[n+]3cc[nH]c3)cc2Cn2ccnc2)cn1.
What is the InChIKey of 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole?
The InChIKey is YSFJZLVJLAOPGF-UHFFFAOYSA-P. The full InChI is InChI=1S/C22H22N8/c1-5-27(15-23-1)11-19-9-21(13-29-7-3-25-17-29)22(14-30-8-4-26-18-30)10-20(19)12-28-6-2-24-16-28/h1-10,15-18H,11-14H2/p+2.
What are the key properties of 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole?
1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole has a molecular weight of 400.49 g/mol, XLogP of 1.50, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4,5-bis(1H-imidazol-3-ium-3-ylmethyl)-2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole is sourced from PubChem (CID 58721007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).