C13H27N3O5S — CID 58721598
[2-[2-[4-(3-methylbutyl)piperazin-1-yl]ethoxy]-2-oxoethyl]sulfamic acid (PubChem CID 58721598) has the molecular formula C13H27N3O5S and a molecular weight of 337.44 g/mol. Its IUPAC name is [2-[2-[4-(3-methylbutyl)piperazin-1-yl]ethoxy]-2-oxoethyl]sulfamic acid.
| Compound Name | [2-[2-[4-(3-methylbutyl)piperazin-1-yl]ethoxy]-2-oxoethyl]sulfamic acid |
|---|---|
| PubChem CID | 58721598 |
| Molecular Formula | C13H27N3O5S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | [2-[2-[4-(3-methylbutyl)piperazin-1-yl]ethoxy]-2-oxoethyl]sulfamic acid |
| SMILES | CC(C)CCN1CCN(CCOC(=O)CNS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C13H27N3O5S/c1-12(2)3-4-15-5-7-16(8-6-15)9-10-21-13(17)11-14-22(18,19)20/h12,14H,3-11H2,1-2H3,(H,18,19,20) |
| InChIKey | TYIBZZCAZCIRNU-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|