C17H16FNO2S — CID 58721788
N-[(2R)-4-[5-[(4-fluorophenyl)methyl]thiophen-2-yl]but-3-yn-2-yl]-N-hydroxyacetamide (PubChem CID 58721788) has the molecular formula C17H16FNO2S and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[(2R)-4-[5-[(4-fluorophenyl)methyl]thiophen-2-yl]but-3-yn-2-yl]-N-hydroxyacetamide.
| Compound Name | N-[(2R)-4-[5-[(4-fluorophenyl)methyl]thiophen-2-yl]but-3-yn-2-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 58721788 |
| Molecular Formula | C17H16FNO2S |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-[(2R)-4-[5-[(4-fluorophenyl)methyl]thiophen-2-yl]but-3-yn-2-yl]-N-hydroxyacetamide |
| SMILES | CC(=O)N(O)[C@H](C)C#Cc1ccc(Cc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C17H16FNO2S/c1-12(19(21)13(2)20)3-8-16-9-10-17(22-16)11-14-4-6-15(18)7-5-14/h4-7,9-10,12,21H,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | DZBAFUQATXHFKO-GFCCVEGCSA-N |
| XLogP | 3.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|