C16H17FN2O2S — CID 123182132
5-[(4-fluorophenyl)methyl]-2-(3-oxobutan-2-ylamino)thiophene-3-carboxamide (PubChem CID 123182132) has the molecular formula C16H17FN2O2S and a molecular weight of 320.39 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-2-(3-oxobutan-2-ylamino)thiophene-3-carboxamide.
| Compound Name | 5-[(4-fluorophenyl)methyl]-2-(3-oxobutan-2-ylamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 123182132 |
| Molecular Formula | C16H17FN2O2S |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-2-(3-oxobutan-2-ylamino)thiophene-3-carboxamide |
| SMILES | CC(=O)C(C)Nc1sc(Cc2ccc(F)cc2)cc1C(N)=O |
| InChI | InChI=1S/C16H17FN2O2S/c1-9(10(2)20)19-16-14(15(18)21)8-13(22-16)7-11-3-5-12(17)6-4-11/h3-6,8-9,19H,7H2,1-2H3,(H2,18,21) |
| InChIKey | CEEJFNBSQREURE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |