C30H36NO2P — CID 58723477
2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]ethyl-triphenylphosphanium (PubChem CID 58723477) has the molecular formula C30H36NO2P and a molecular weight of 473.60 g/mol. Its IUPAC name is 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]ethyl-triphenylphosphanium.
| Compound Name | 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]ethyl-triphenylphosphanium |
|---|---|
| PubChem CID | 58723477 |
| Molecular Formula | C30H36NO2P |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]ethyl-triphenylphosphanium |
| SMILES | CC(C)(C)OC(=O)N1CCC([CH-]C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H36NO2P/c1-30(2,3)33-29(32)31-22-19-25(20-23-31)21-24-34(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-18,21,25H,19-20,22-24H2,1-3H3 |
| InChIKey | QPAXXEWZMQCXKZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|