C23H33F3N2O3 — CID 58725003
(3S)-3-amino-4-[4-(5-cyclohexylpentyl)-3-(trifluoromethyl)anilino]-3-methyl-4-oxobutanoic acid (PubChem CID 58725003) has the molecular formula C23H33F3N2O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is (3S)-3-amino-4-[4-(5-cyclohexylpentyl)-3-(trifluoromethyl)anilino]-3-methyl-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[4-(5-cyclohexylpentyl)-3-(trifluoromethyl)anilino]-3-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58725003 |
| Molecular Formula | C23H33F3N2O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (3S)-3-amino-4-[4-(5-cyclohexylpentyl)-3-(trifluoromethyl)anilino]-3-methyl-4-oxobutanoic acid |
| SMILES | C[C@](N)(CC(=O)O)C(=O)Nc1ccc(CCCCCC2CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H33F3N2O3/c1-22(27,15-20(29)30)21(31)28-18-13-12-17(19(14-18)23(24,25)26)11-7-3-6-10-16-8-4-2-5-9-16/h12-14,16H,2-11,15,27H2,1H3,(H,28,31)(H,29,30)/t22-/m0/s1 |
| InChIKey | VOEFVSSICKBPCC-QFIPXVFZSA-N |
| XLogP | 5.52 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|