C30H41F3N4O6 — CID 58726294
(6S,9S,12R)-6-ethyl-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 58726294) has the molecular formula C30H41F3N4O6 and a molecular weight of 610.67 g/mol. Its IUPAC name is (6S,9S,12R)-6-ethyl-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (6S,9S,12R)-6-ethyl-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 58726294 |
| Molecular Formula | C30H41F3N4O6 |
| Molecular Weight | 610.67 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | (6S,9S,12R)-6-ethyl-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCCCC(=O)[C@@H](C)O)NC(=O)[C@H]2CCCN2C(=O)C(Cc2ccc(C(F)(F)F)cc2)NC1=O |
| InChI | InChI=1S/C30H41F3N4O6/c1-4-29(3)28(43)35-22(17-19-12-14-20(15-13-19)30(31,32)33)27(42)37-16-8-10-23(37)26(41)34-21(25(40)36-29)9-6-5-7-11-24(39)18(2)38/h12-15,18,21-23,38H,4-11,16-17H2,1-3H3,(H,34,41)(H,35,43)(H,36,40)/t18-,21+,22?,23-,29+/m1/s1 |
| InChIKey | ILAHCAZPJQZKLJ-LELKOBSESA-N |
| XLogP | 2.41 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.67 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|