C15H33B2N5O6 — CID 58726772
N-[(E)-6-(3-aminopropylamino)-1-methoxy-2-nitro-1-oxohex-2-en-3-yl]-N-[3-[[hydroxy(methyl)boranyl]amino]propyl]-methylboronamidic acid (PubChem CID 58726772) has the molecular formula C15H33B2N5O6 and a molecular weight of 401.08 g/mol. Its IUPAC name is N-[(E)-6-(3-aminopropylamino)-1-methoxy-2-nitro-1-oxohex-2-en-3-yl]-N-[3-[[hydroxy(methyl)boranyl]amino]propyl]-methylboronamidic acid.
| Compound Name | N-[(E)-6-(3-aminopropylamino)-1-methoxy-2-nitro-1-oxohex-2-en-3-yl]-N-[3-[[hydroxy(methyl)boranyl]amino]propyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 58726772 |
| Molecular Formula | C15H33B2N5O6 |
| Molecular Weight | 401.08 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | N-[(E)-6-(3-aminopropylamino)-1-methoxy-2-nitro-1-oxohex-2-en-3-yl]-N-[3-[[hydroxy(methyl)boranyl]amino]propyl]-methylboronamidic acid |
| SMILES | COC(=O)/C(=C(/CCCNCCCN)N(CCCNB(C)O)B(C)O)[N+](=O)[O-] |
| InChI | InChI=1S/C15H33B2N5O6/c1-16(24)20-11-6-12-21(17(2)25)13(7-4-9-19-10-5-8-18)14(22(26)27)15(23)28-3/h19-20,24-25H,4-12,18H2,1-3H3/b14-13+ |
| InChIKey | YTPSZDQWACYFKX-BUHFOSPRSA-N |
| XLogP | -1.13 |
| TPSA | 163.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.08 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|