C17H40N6O2 — CID 20681691
(dimethylamino)methyl 2-[bis[3-(3-aminopropylamino)propyl]amino]acetate (PubChem CID 20681691) has the molecular formula C17H40N6O2 and a molecular weight of 360.55 g/mol. Its IUPAC name is (dimethylamino)methyl 2-[bis[3-(3-aminopropylamino)propyl]amino]acetate.
| Compound Name | (dimethylamino)methyl 2-[bis[3-(3-aminopropylamino)propyl]amino]acetate |
|---|---|
| PubChem CID | 20681691 |
| Molecular Formula | C17H40N6O2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.32 |
| IUPAC Name | (dimethylamino)methyl 2-[bis[3-(3-aminopropylamino)propyl]amino]acetate |
| SMILES | CN(C)COC(=O)CN(CCCNCCCN)CCCNCCCN |
| InChI | InChI=1S/C17H40N6O2/c1-22(2)16-25-17(24)15-23(13-5-11-20-9-3-7-18)14-6-12-21-10-4-8-19/h20-21H,3-16,18-19H2,1-2H3 |
| InChIKey | SOBCVGZJZIDGFH-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|