C17H16BrN2O4Y- — CID 58729198
(2S)-4-(4-bromophenyl)-2-hydroxy-2-methyl-N-(4-nitrobenzene-5-id-1-yl)butanamide;yttrium (PubChem CID 58729198) has the molecular formula C17H16BrN2O4Y- and a molecular weight of 481.14 g/mol. Its IUPAC name is (2S)-4-(4-bromophenyl)-2-hydroxy-2-methyl-N-(4-nitrobenzene-5-id-1-yl)butanamide;yttrium.
| Compound Name | (2S)-4-(4-bromophenyl)-2-hydroxy-2-methyl-N-(4-nitrobenzene-5-id-1-yl)butanamide;yttrium |
|---|---|
| PubChem CID | 58729198 |
| Molecular Formula | C17H16BrN2O4Y- |
| Molecular Weight | 481.14 g/mol |
| Exact Mass | 479.94 |
| IUPAC Name | (2S)-4-(4-bromophenyl)-2-hydroxy-2-methyl-N-(4-nitrobenzene-5-id-1-yl)butanamide;yttrium |
| SMILES | C[C@](O)(CCc1ccc(Br)cc1)C(=O)Nc1c[c-]c([N+](=O)[O-])cc1.[Y] |
| InChI | InChI=1S/C17H16BrN2O4.Y/c1-17(22,11-10-12-2-4-13(18)5-3-12)16(21)19-14-6-8-15(9-7-14)20(23)24;/h2-8,22H,10-11H2,1H3,(H,19,21);/q-1;/t17-;/m0./s1 |
| InChIKey | AVBFJVINCWQIKE-LMOVPXPDSA-N |
| XLogP | 3.48 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.14 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|