C18H20NO2Y- — CID 58930733
(2S)-2-hydroxy-2-methyl-N-(4-methylbenzene-5-id-1-yl)-3-(4-methylphenyl)propanamide;yttrium (PubChem CID 58930733) has the molecular formula C18H20NO2Y- and a molecular weight of 371.27 g/mol. Its IUPAC name is (2S)-2-hydroxy-2-methyl-N-(4-methylbenzene-5-id-1-yl)-3-(4-methylphenyl)propanamide;yttrium.
| Compound Name | (2S)-2-hydroxy-2-methyl-N-(4-methylbenzene-5-id-1-yl)-3-(4-methylphenyl)propanamide;yttrium |
|---|---|
| PubChem CID | 58930733 |
| Molecular Formula | C18H20NO2Y- |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (2S)-2-hydroxy-2-methyl-N-(4-methylbenzene-5-id-1-yl)-3-(4-methylphenyl)propanamide;yttrium |
| SMILES | Cc1[c-]cc(NC(=O)[C@@](C)(O)Cc2ccc(C)cc2)cc1.[Y] |
| InChI | InChI=1S/C18H20NO2.Y/c1-13-4-8-15(9-5-13)12-18(3,21)17(20)19-16-10-6-14(2)7-11-16;/h4-6,8-11,21H,12H2,1-3H3,(H,19,20);/q-1;/t18-;/m0./s1 |
| InChIKey | IEPCJYNMNRXKQN-FERBBOLQSA-N |
| XLogP | 3.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|