C19H22NO2Y- — CID 161325761
(2R)-2-methyl-3-[(4-methylbenzene-5-id-1-yl)amino]-1-(4-methylphenoxy)but-3-en-2-ol;yttrium (PubChem CID 161325761) has the molecular formula C19H22NO2Y- and a molecular weight of 385.30 g/mol. Its IUPAC name is (2R)-2-methyl-3-[(4-methylbenzene-5-id-1-yl)amino]-1-(4-methylphenoxy)but-3-en-2-ol;yttrium.
| Compound Name | (2R)-2-methyl-3-[(4-methylbenzene-5-id-1-yl)amino]-1-(4-methylphenoxy)but-3-en-2-ol;yttrium |
|---|---|
| PubChem CID | 161325761 |
| Molecular Formula | C19H22NO2Y- |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (2R)-2-methyl-3-[(4-methylbenzene-5-id-1-yl)amino]-1-(4-methylphenoxy)but-3-en-2-ol;yttrium |
| SMILES | C=C(Nc1c[c-]c(C)cc1)[C@@](C)(O)COc1ccc(C)cc1.[Y] |
| InChI | InChI=1S/C19H22NO2.Y/c1-14-5-9-17(10-6-14)20-16(3)19(4,21)13-22-18-11-7-15(2)8-12-18;/h5,7-12,20-21H,3,13H2,1-2,4H3;/q-1;/t19-;/m0./s1 |
| InChIKey | QHQHPLNRFWQTES-FYZYNONXSA-N |
| XLogP | 3.86 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|