C12H20NO4Y- — CID 58729950
3-oxo-3-(2,2,6,6-tetramethylpiperidin-1-id-4-yl)oxypropanoic acid;yttrium (PubChem CID 58729950) has the molecular formula C12H20NO4Y- and a molecular weight of 331.20 g/mol. Its IUPAC name is 3-oxo-3-(2,2,6,6-tetramethylpiperidin-1-id-4-yl)oxypropanoic acid;yttrium.
| Compound Name | 3-oxo-3-(2,2,6,6-tetramethylpiperidin-1-id-4-yl)oxypropanoic acid;yttrium |
|---|---|
| PubChem CID | 58729950 |
| Molecular Formula | C12H20NO4Y- |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 3-oxo-3-(2,2,6,6-tetramethylpiperidin-1-id-4-yl)oxypropanoic acid;yttrium |
| SMILES | CC1(C)CC(OC(=O)CC(=O)O)CC(C)(C)[N-]1.[Y] |
| InChI | InChI=1S/C12H20NO4.Y/c1-11(2)6-8(7-12(3,4)13-11)17-10(16)5-9(14)15;/h8H,5-7H2,1-4H3,(H,14,15);/q-1; |
| InChIKey | VQQVHJAUHPWQBK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 77.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|