C13H22NO3+ — CID 58732123
[1,1-dihydroxy-3-(4-hydroxyphenyl)-2-methylpropan-2-yl]-trimethylazanium (PubChem CID 58732123) has the molecular formula C13H22NO3+ and a molecular weight of 240.32 g/mol. Its IUPAC name is [1,1-dihydroxy-3-(4-hydroxyphenyl)-2-methylpropan-2-yl]-trimethylazanium.
| Compound Name | [1,1-dihydroxy-3-(4-hydroxyphenyl)-2-methylpropan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 58732123 |
| Molecular Formula | C13H22NO3+ |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | [1,1-dihydroxy-3-(4-hydroxyphenyl)-2-methylpropan-2-yl]-trimethylazanium |
| SMILES | CC(Cc1ccc(O)cc1)(C(O)O)[N+](C)(C)C |
| InChI | InChI=1S/C13H21NO3/c1-13(12(16)17,14(2,3)4)9-10-5-7-11(15)8-6-10/h5-8,12,16-17H,9H2,1-4H3/p+1 |
| InChIKey | JCWDUUUKSIQXFX-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|