C14H12I2O2 — CID 70440084
4-[2-(4-hydroxyphenyl)-2,2-diiodoethyl]phenol (PubChem CID 70440084) has the molecular formula C14H12I2O2 and a molecular weight of 466.06 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)-2,2-diiodoethyl]phenol.
| Compound Name | 4-[2-(4-hydroxyphenyl)-2,2-diiodoethyl]phenol |
|---|---|
| PubChem CID | 70440084 |
| Molecular Formula | C14H12I2O2 |
| Molecular Weight | 466.06 g/mol |
| Exact Mass | 465.89 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)-2,2-diiodoethyl]phenol |
| SMILES | Oc1ccc(CC(I)(I)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C14H12I2O2/c15-14(16,11-3-7-13(18)8-4-11)9-10-1-5-12(17)6-2-10/h1-8,17-18H,9H2 |
| InChIKey | RJEWLIYBYQHASI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.06 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|