C30H31FN5O7P — CID 58732467
methyl 2-[[[(2R,3R,4R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate (PubChem CID 58732467) has the molecular formula C30H31FN5O7P and a molecular weight of 623.58 g/mol. Its IUPAC name is methyl 2-[[[(2R,3R,4R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[[(2R,3R,4R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 58732467 |
| Molecular Formula | C30H31FN5O7P |
| Molecular Weight | 623.58 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | methyl 2-[[[(2R,3R,4R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate |
| SMILES | C#Cc1cn([C@@H]2O[C@H](COP(=O)(NC(Cc3ccccc3)C(=O)OC)Oc3ccccc3)[C@@H](O)[C@@]2(C)F)c2ncnc(N)c12 |
| InChI | InChI=1S/C30H31FN5O7P/c1-4-20-16-36(27-24(20)26(32)33-18-34-27)29-30(2,31)25(37)23(42-29)17-41-44(39,43-21-13-9-6-10-14-21)35-22(28(38)40-3)15-19-11-7-5-8-12-19/h1,5-14,16,18,22-23,25,29,37H,15,17H2,2-3H3,(H,35,39)(H2,32,33,34)/t22?,23-,25-,29-,30-,44?/m1/s1 |
| InChIKey | CZQMAUUDTGPJLY-TYKHARTQSA-N |
| XLogP | 3.56 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|