C19H24FN5O4 — CID 58732364
[(2R,3R,4R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl 2-amino-3-methylbutanoate (PubChem CID 58732364) has the molecular formula C19H24FN5O4 and a molecular weight of 405.43 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl 2-amino-3-methylbutanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 58732364 |
| Molecular Formula | C19H24FN5O4 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl 2-amino-3-methylbutanoate |
| SMILES | C#Cc1cn([C@@H]2O[C@H](COC(=O)C(N)C(C)C)[C@@H](O)[C@@]2(C)F)c2ncnc(N)c12 |
| InChI | InChI=1S/C19H24FN5O4/c1-5-10-6-25(16-12(10)15(22)23-8-24-16)18-19(4,20)14(26)11(29-18)7-28-17(27)13(21)9(2)3/h1,6,8-9,11,13-14,18,26H,7,21H2,2-4H3,(H2,22,23,24)/t11-,13?,14-,18-,19-/m1/s1 |
| InChIKey | MFPXILYKFKFFDP-SZVSXMRLSA-N |
| XLogP | 0.51 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|