C26H31FN5O8P — CID 58732420
methyl 2-[[[(2R,3R,4R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]-2-methylpropanoate (PubChem CID 58732420) has the molecular formula C26H31FN5O8P and a molecular weight of 591.53 g/mol. Its IUPAC name is methyl 2-[[[(2R,3R,4R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[[(2R,3R,4R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 58732420 |
| Molecular Formula | C26H31FN5O8P |
| Molecular Weight | 591.53 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | methyl 2-[[[(2R,3R,4R,5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]-2-methylpropanoate |
| SMILES | C#Cc1cn([C@@H]2O[C@H](COP(=O)(NC(C)(C)C(=O)OC)Oc3ccc(OC)cc3)[C@@H](O)[C@@]2(C)F)c2ncnc(N)c12 |
| InChI | InChI=1S/C26H31FN5O8P/c1-7-15-12-32(22-19(15)21(28)29-14-30-22)23-26(4,27)20(33)18(39-23)13-38-41(35,31-25(2,3)24(34)37-6)40-17-10-8-16(36-5)9-11-17/h1,8-12,14,18,20,23,33H,13H2,2-6H3,(H,31,35)(H2,28,29,30)/t18-,20-,23-,26-,41?/m1/s1 |
| InChIKey | OQDZEQCNTGRDLA-SOGHBFQYSA-N |
| XLogP | 2.73 |
| TPSA | 169.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|