C20H18F4N2O — CID 58733826
1-[3-[2-(2-fluorophenyl)ethyl]-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]ethanol (PubChem CID 58733826) has the molecular formula C20H18F4N2O and a molecular weight of 378.37 g/mol. Its IUPAC name is 1-[3-[2-(2-fluorophenyl)ethyl]-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]ethanol.
| Compound Name | 1-[3-[2-(2-fluorophenyl)ethyl]-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]ethanol |
|---|---|
| PubChem CID | 58733826 |
| Molecular Formula | C20H18F4N2O |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-[3-[2-(2-fluorophenyl)ethyl]-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]ethanol |
| SMILES | CC(O)c1cn(-c2ccc(C(F)(F)F)cc2)nc1CCc1ccccc1F |
| InChI | InChI=1S/C20H18F4N2O/c1-13(27)17-12-26(16-9-7-15(8-10-16)20(22,23)24)25-19(17)11-6-14-4-2-3-5-18(14)21/h2-5,7-10,12-13,27H,6,11H2,1H3 |
| InChIKey | PSXUEBGZLNNKDS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |