C30H30N4O2S — CID 58739873
2-amino-4-(4-methoxyphenyl)-6-[2-oxo-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethyl]sulfanylpyridine-3,5-dicarbonitrile (PubChem CID 58739873) has the molecular formula C30H30N4O2S and a molecular weight of 510.66 g/mol. Its IUPAC name is 2-amino-4-(4-methoxyphenyl)-6-[2-oxo-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethyl]sulfanylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(4-methoxyphenyl)-6-[2-oxo-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethyl]sulfanylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 58739873 |
| Molecular Formula | C30H30N4O2S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 2-amino-4-(4-methoxyphenyl)-6-[2-oxo-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethyl]sulfanylpyridine-3,5-dicarbonitrile |
| SMILES | COc1ccc(-c2c(C#N)c(N)nc(SCC(=O)c3ccc4c(c3)C(C)(C)CCC4(C)C)c2C#N)cc1 |
| InChI | InChI=1S/C30H30N4O2S/c1-29(2)12-13-30(3,4)24-14-19(8-11-23(24)29)25(35)17-37-28-22(16-32)26(21(15-31)27(33)34-28)18-6-9-20(36-5)10-7-18/h6-11,14H,12-13,17H2,1-5H3,(H2,33,34) |
| InChIKey | PAABSZNIRQVDHD-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |