C26H21NO6 — CID 58740948
2-[1-[4-(1,3-benzodioxol-2-ylmethoxy)benzoyl]-2-methylindol-3-yl]acetic acid (PubChem CID 58740948) has the molecular formula C26H21NO6 and a molecular weight of 443.46 g/mol. Its IUPAC name is 2-[1-[4-(1,3-benzodioxol-2-ylmethoxy)benzoyl]-2-methylindol-3-yl]acetic acid.
| Compound Name | 2-[1-[4-(1,3-benzodioxol-2-ylmethoxy)benzoyl]-2-methylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 58740948 |
| Molecular Formula | C26H21NO6 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[1-[4-(1,3-benzodioxol-2-ylmethoxy)benzoyl]-2-methylindol-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2ccccc2n1C(=O)c1ccc(OCC2Oc3ccccc3O2)cc1 |
| InChI | InChI=1S/C26H21NO6/c1-16-20(14-24(28)29)19-6-2-3-7-21(19)27(16)26(30)17-10-12-18(13-11-17)31-15-25-32-22-8-4-5-9-23(22)33-25/h2-13,25H,14-15H2,1H3,(H,28,29) |
| InChIKey | QUYJMBFLZMWDAQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |